![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 14. Build a Personal Website/ | 2022-10-30 00:33 | - | |
| 13. Aside - Lists/ | 2022-10-30 00:33 | - | |
| 12. Proper document structure/ | 2022-10-30 00:33 | - | |
| 11. Add an anchor tag to Google.com/ | 2022-10-30 00:33 | - | |
| 10. Aside - Anchor Tags/ | 2022-10-30 00:33 | - | |
| 9. Lets build Google/ | 2022-10-30 00:33 | - | |
| 8. Interactive elements - input tags - input types/ | 2022-10-30 00:33 | - | |
| 7. Interactive elements - button/ | 2022-10-30 00:33 | - | |
| 5. Nesting/ | 2022-10-30 00:33 | - | |
| 4. The img tag/ | 2022-10-30 00:33 | - | |
| 3. Write a news article/ | 2022-10-30 00:33 | - | |
| 2. HTML tags/ | 2022-10-30 00:33 | - | |
| 1. Welcome to the HTML and CSS course/ | 2022-10-30 00:33 | - | |